Products 1158019-66-9
CAS 1158019-66-9 is the registry number for (E)-1-(2,4-Dihydroxyphenyl)-3-(4-((3-methylbut-2-en-1-yl)oxy)phenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(2,4-dihydroxyphenyl)-3-[4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one (CAS 1158019-66-9) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: (E)-1-(2,4-dihydroxyphenyl)-3-[4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one. InChIKey: VVSZRCIUFBADJQ-BJMVGYQFSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (E)-1-(2,4-dihydroxyphenyl)-3-[4-(3-methylbut-2-enoxy)phenyl]prop-2-en-1-one |
| InChIKey | VVSZRCIUFBADJQ-BJMVGYQFSA-N |
| SMILES | CC(=CCOC1=CC=C(C=C1)/C=C/C(=O)C2=C(C=C(C=C2)O)O)C |
Computed by PubChem (NCBI)