CAS 3569-18-4 is the registry number for 3-(4-Carboxyphenyl)-1,1,3-trimethylindane-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-carboxyphenyl)-1,1,3-trimethyl-2H-indene-5-carboxylic acid (CAS 3569-18-4) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: 3-(4-carboxyphenyl)-1,1,3-trimethyl-2H-indene-5-carboxylic acid. InChIKey: CDZMWAHBQLPCHD-UHFFFAOYSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 3-(4-carboxyphenyl)-1,1,3-trimethyl-2H-indene-5-carboxylic acid |
| InChIKey | CDZMWAHBQLPCHD-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C1C=CC(=C2)C(=O)O)(C)C3=CC=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)