Products 3569-18-4

CAS 3569-18-4 is the registry number for 3-(4-Carboxyphenyl)-1,1,3-trimethylindane-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(4-carboxyphenyl)-1,1,3-trimethyl-2H-indene-5-carboxylic acid (CAS 3569-18-4) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: 3-(4-carboxyphenyl)-1,1,3-trimethyl-2H-indene-5-carboxylic acid. InChIKey: CDZMWAHBQLPCHD-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20O4
Molecular weight324.4 g/mol
IUPAC name3-(4-carboxyphenyl)-1,1,3-trimethyl-2H-indene-5-carboxylic acid
InChIKeyCDZMWAHBQLPCHD-UHFFFAOYSA-N
SMILESCC1(CC(C2=C1C=CC(=C2)C(=O)O)(C)C3=CC=C(C=C3)C(=O)O)C

Computed by PubChem (NCBI)