cas: 5057-96-5 — see every product listed under this CAS number, including other names
Dimethyl meso-tartrate, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 5057-96-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILSE-5g |
| cas | 5057-96-5 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 342.80 Pln | |
| Chemat | 100g | 731.60 Pln | |
| Chemat | 500g | 2625.60 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Dimethyl (2R,3S)-2,3-dihydroxybutanedioate (CAS 5057-96-5) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: dimethyl (2R,3S)-2,3-dihydroxybutanedioate. InChIKey: PVRATXCXJDHJJN-ZXZARUISSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | dimethyl (2R,3S)-2,3-dihydroxybutanedioate |
| InChIKey | PVRATXCXJDHJJN-ZXZARUISSA-N |
| SMILES | COC(=O)[C@@H]([C@@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)