CAS 5057-96-5 appears in our catalog under these names: rel-(2R,3S)-Dimethyl 2,3-dihydroxysuccinate, 97%, Dimethyl meso-tartrate, 98%(GC-MS),RG, 98%(GC-MS),RG. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 5g, 25g, 100g, 500g.
Dimethyl (2R,3S)-2,3-dihydroxybutanedioate (CAS 5057-96-5) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: dimethyl (2R,3S)-2,3-dihydroxybutanedioate. InChIKey: PVRATXCXJDHJJN-ZXZARUISSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | dimethyl (2R,3S)-2,3-dihydroxybutanedioate |
| InChIKey | PVRATXCXJDHJJN-ZXZARUISSA-N |
| SMILES | COC(=O)[C@@H]([C@@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)