CAS 15374-15-9 appears in our catalog under these names: Promethazine Sulfone Hydrochloride, Dioxopromethazine hydrochloride, Dioxopromethazine hydrochloride/ 99%, Dioxopromethazine hydrochloride, 98%, 98%, Dioxopromethazine hydrochloride, 99.97%. Offered by: Mikromol, Dr. Ehrenstorfer, GLPBio, TargetMol, Chemat. Available pack sizes: 4x25mg, 25mg, 50mg, 5mg, 10mg, 100mg, 200mg, 5g.
1-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-2-amine;hydrochloride (CAS 15374-15-9) is a chemical compound with the molecular formula C17H21ClN2O2S and a molecular weight of 352.9 g/mol. IUPAC name: 1-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-2-amine;hydrochloride. InChIKey: LPDLZVGJDFEWFD-UHFFFAOYSA-N.
| Molecular formula | C17H21ClN2O2S |
|---|---|
| Molecular weight | 352.9 g/mol |
| IUPAC name | 1-(5,5-dioxophenothiazin-10-yl)-N,N-dimethylpropan-2-amine;hydrochloride |
| InChIKey | LPDLZVGJDFEWFD-UHFFFAOYSA-N |
| SMILES | CC(CN1C2=CC=CC=C2S(=O)(=O)C3=CC=CC=C31)N(C)C.Cl |
Computed by PubChem (NCBI)