CAS 2253744-54-4 appears in our catalog under these names: Dooku1/ 99.4% (existing batch purity), Dooku1, Dooku1 98%, 2-((2,6-Dichlorobenzyl)Thio)-5-(1H-Pyrrol-2-Yl)-1,3,4-Oxadiazole, 98%, 98%, Dooku1, 99.93%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g.
2-[(2,6-dichlorophenyl)methylsulfanyl]-5-(1H-pyrrol-2-yl)-1,3,4-oxadiazole (CAS 2253744-54-4) is a chemical compound with the molecular formula C13H9Cl2N3OS and a molecular weight of 326.2 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)methylsulfanyl]-5-(1H-pyrrol-2-yl)-1,3,4-oxadiazole. InChIKey: MNPOBXLPCWFONX-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3OS |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-5-(1H-pyrrol-2-yl)-1,3,4-oxadiazole |
| InChIKey | MNPOBXLPCWFONX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CSC2=NN=C(O2)C3=CC=CN3)Cl |
Computed by PubChem (NCBI)