CAS 1140964-99-3 appears in our catalog under these names: E7449/ 97.13% (existing batch purity), E7449, E 7449, Stenoparib 98%, Stenoparib, 98.0%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
11-(1,3-dihydroisoindol-2-ylmethyl)-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8,11-pentaen-4-one (CAS 1140964-99-3) is a chemical compound with the molecular formula C18H15N5O and a molecular weight of 317.3 g/mol. IUPAC name: 11-(1,3-dihydroisoindol-2-ylmethyl)-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8,11-pentaen-4-one. InChIKey: JLFSBHQQXIAQEC-UHFFFAOYSA-N.
| Molecular formula | C18H15N5O |
|---|---|
| Molecular weight | 317.3 g/mol |
| IUPAC name | 11-(1,3-dihydroisoindol-2-ylmethyl)-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8,11-pentaen-4-one |
| InChIKey | JLFSBHQQXIAQEC-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CN1CC3=NC4=NNC(=O)C5=C4C(=CC=C5)N3 |
Computed by PubChem (NCBI)