CAS 1429329-63-4 appears in our catalog under these names: EN3356/ 97.47% (existing batch purity), EN3356, ASN-001. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
1-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-1-pyridin-4-ylethanol (CAS 1429329-63-4) is a chemical compound with the molecular formula C16H13FN2OS and a molecular weight of 300.4 g/mol. IUPAC name: 1-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-1-pyridin-4-ylethanol. InChIKey: AQVYQEWAZCIHMU-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2OS |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 1-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-1-pyridin-4-ylethanol |
| InChIKey | AQVYQEWAZCIHMU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=NC=C1)(C2=CN=C(S2)C3=CC=C(C=C3)F)O |
Computed by PubChem (NCBI)