cas: 129053-83-4 — see every product listed under this CAS number, including other names
ETHYL 3-[(1H-PYRROLE-2-CARBONYL)-AMINO]PROPIONATE (CAS 129053-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111YTP-100mg |
| cas | 129053-83-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 746.00 Pln | |
| Chemat | 250mg | 1370.00 Pln |
| delivery time | 3 weeks |
|---|
Ethyl 3-(1H-pyrrole-2-carbonylamino)propanoate (CAS 129053-83-4) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: ethyl 3-(1H-pyrrole-2-carbonylamino)propanoate. InChIKey: XWDQZWGZHHUXPQ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | ethyl 3-(1H-pyrrole-2-carbonylamino)propanoate |
| InChIKey | XWDQZWGZHHUXPQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCNC(=O)C1=CC=CN1 |
Computed by PubChem (NCBI)