CAS 890596-67-5 appears in our catalog under these names: 3-(4-Acetyl-3,5-dimethyl-1h-pyrazol-1-yl)propanoic acid, 95%, 3-(4-Acetyl-3,5-dimethyl-pyrazol-1-yl)-propionic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
3-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid (CAS 890596-67-5) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: 3-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid. InChIKey: XQLFKVOEQTWWDK-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-(4-acetyl-3,5-dimethylpyrazol-1-yl)propanoic acid |
| InChIKey | XQLFKVOEQTWWDK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCC(=O)O)C)C(=O)C |
Computed by PubChem (NCBI)