Products 81959-10-6
CAS 81959-10-6 appears in our catalog under these names: Methyl (2s)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoate dihydrochloride, 96%, MEthyl (2s)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoate (CAS 81959-10-6) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoate. InChIKey: KZGGIOWCNWQXAZ-QMMMGPOBSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3-amino-4-hydroxyphenyl)propanoate |
| InChIKey | KZGGIOWCNWQXAZ-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=C(C=C1)O)N)N |
Computed by PubChem (NCBI)