CAS 51344-13-9 is the registry number for N,N-Dimethyl-2-(4-nitrophenoxy)ethanamine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
N,N-dimethyl-2-(4-nitrophenoxy)ethanamine (CAS 51344-13-9) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: N,N-dimethyl-2-(4-nitrophenoxy)ethanamine. InChIKey: YHVRYYYYYRDIAL-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | N,N-dimethyl-2-(4-nitrophenoxy)ethanamine |
| InChIKey | YHVRYYYYYRDIAL-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)