cas: 1255098-82-8 — see every product listed under this CAS number, including other names
ETHYL 5-BROMO-4-AZAINDOLE-2-CARBOXYLATE, 95% (CAS 1255098-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301239-100MG |
| cas | 1255098-82-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 500mg | 253.05 Pln | |
| Fluorochem | 1g | 450.90 Pln | |
| Fluorochem | 5g | 1528.65 Pln | |
| Fluorochem | 10g | 2471.02 Pln | |
| Fluorochem | 25g | 5225.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (CAS 1255098-82-8) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate. InChIKey: BDJZZKVOBJHYTD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 5-bromo-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
| InChIKey | BDJZZKVOBJHYTD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=N2)Br |
Computed by PubChem (NCBI)