CAS 890094-11-8 is the registry number for Methyl 3-amino-5-bromo-1h-indole-2-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-amino-5-bromo-1H-indole-2-carboxylate (CAS 890094-11-8) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: methyl 3-amino-5-bromo-1H-indole-2-carboxylate. InChIKey: STGQKSMTFMBFMB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | methyl 3-amino-5-bromo-1H-indole-2-carboxylate |
| InChIKey | STGQKSMTFMBFMB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(N1)C=CC(=C2)Br)N |
Computed by PubChem (NCBI)