Products 956796-80-8
CAS 956796-80-8 appears in our catalog under these names: 5-(2-Bromophenyl)-5-methylimidazolidine-2,4-dione, 95%, 5-(2-Bromophenyl)-5-methylimidazolidine-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
5-(2-bromophenyl)-5-methylimidazolidine-2,4-dione (CAS 956796-80-8) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 5-(2-bromophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: YSQLGMDDAXPBON-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 5-(2-bromophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | YSQLGMDDAXPBON-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)