CAS 957103-97-8 is the registry number for Ethyl 8-bromoimidazo[1,2-a]pyridine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 8-bromoimidazo[1,2-a]pyridine-6-carboxylate (CAS 957103-97-8) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 8-bromoimidazo[1,2-a]pyridine-6-carboxylate. InChIKey: ADCJRWHNVNKULP-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 8-bromoimidazo[1,2-a]pyridine-6-carboxylate |
| InChIKey | ADCJRWHNVNKULP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=CN=C2C(=C1)Br |
Computed by PubChem (NCBI)