CAS 41933-33-9 appears in our catalog under these names: EcDsbB–IN–9, EcDsbB-IN-9, 97.0%, EcDsbB-IN-9, 97%, EcDsbB-IN-9/ 99.92% (existing batch purity), 2-Benzyl-4,5-dichloro-2,3-dihydropyridazin-3-one, 97%. Offered by: GLPBio, MedChemExpress, Ambeed, TargetMol, Combi-blocks. Available pack sizes: 250mg, 500 mg, 10mM/1mL, 5 g, 1 g, 100mg, 1g, 5g.
2-benzyl-4,5-dichloropyridazin-3-one (CAS 41933-33-9) is a chemical compound with the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. IUPAC name: 2-benzyl-4,5-dichloropyridazin-3-one. InChIKey: AJHBQZQCDCTOFD-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 2-benzyl-4,5-dichloropyridazin-3-one |
| InChIKey | AJHBQZQCDCTOFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C(=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)