CAS 1127-99-7 appears in our catalog under these names: Ethyl (1S,2R/1R,2S)-2-aminocyclohexanecarboxylate hydrochloride, Ethyl cis-2-amino-1-cyclohexanecarboxylate hydrochloride, 95%, cis-2-Amino-cyclohexanecarboxylic acid ethyl ester hydrochloride, 98%, 98%. Offered by: Biosynth, Thermo Scientific (Acros), Chemat. Available pack sizes: 100mg, 1g, 2.5g, 250mg.
Cis-ethyl (1R,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride (CAS 1127-99-7) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: XMQSOBPCWYVZSW-WLYNEOFISA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | XMQSOBPCWYVZSW-WLYNEOFISA-N |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)