CAS 937059-62-6 appears in our catalog under these names: Ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, 98%, Ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, Ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate hydrochloride, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 10g, 0,5g, 50mg, 25mg, 100mg, 250mg, 1g.
Cis-ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride (CAS 937059-62-6) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: cis-ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: MLDUTPQKFFVCJJ-KZYPOYLOSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | cis-ethyl (1S,3R)-3-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | MLDUTPQKFFVCJJ-KZYPOYLOSA-N |
| SMILES | CCOC(=O)[C@H]1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)