cas: 14741-71-0 — see every product listed under this CAS number, including other names
Ethyl (2-benzoimidazolyl)acetate, 96% (CAS 14741-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049985-1G |
| cas | 14741-71-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 378.01 Pln | |
| Fluorochem | 25g | 1632.78 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-(1H-benzimidazol-2-yl)acetate (CAS 14741-71-0) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: ethyl 2-(1H-benzimidazol-2-yl)acetate. InChIKey: JTVPWPDLKUQDAU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | ethyl 2-(1H-benzimidazol-2-yl)acetate |
| InChIKey | JTVPWPDLKUQDAU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)