cas: 2061996-60-7 — see every product listed under this CAS number, including other names
Ethyl (R)-2-amino-3-(4-fluorophenyl)propionate hydrochloride, 98% (CAS 2061996-60-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517513-100MG |
| cas | 2061996-60-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 1481.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride (CAS 2061996-60-7) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: ethyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: KMTPBETYAVWMHD-HNCPQSOCSA-N.
| Molecular formula | C11H15ClFNO2 |
|---|---|
| Molecular weight | 247.69 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | KMTPBETYAVWMHD-HNCPQSOCSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)