CAS 2307299-68-7 is the registry number for Methyl 2-amino-3-(4-fluoro-3-methylphenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-amino-3-(4-fluoro-3-methylphenyl)propanoate;hydrochloride (CAS 2307299-68-7) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: methyl 2-amino-3-(4-fluoro-3-methylphenyl)propanoate;hydrochloride. InChIKey: YIGQQBLHNUXVRG-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFNO2 |
|---|---|
| Molecular weight | 247.69 g/mol |
| IUPAC name | methyl 2-amino-3-(4-fluoro-3-methylphenyl)propanoate;hydrochloride |
| InChIKey | YIGQQBLHNUXVRG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC(C(=O)OC)N)F.Cl |
Computed by PubChem (NCBI)