Products 1956354-84-9

CAS 1956354-84-9 is the registry number for Methyl 3-((dimethylamino)methyl)-5-fluorobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-[(dimethylamino)methyl]-5-fluorobenzoate;hydrochloride (CAS 1956354-84-9) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: methyl 3-[(dimethylamino)methyl]-5-fluorobenzoate;hydrochloride. InChIKey: CAVCFNJIQXTJNN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15ClFNO2
Molecular weight247.69 g/mol
IUPAC namemethyl 3-[(dimethylamino)methyl]-5-fluorobenzoate;hydrochloride
InChIKeyCAVCFNJIQXTJNN-UHFFFAOYSA-N
SMILESCN(C)CC1=CC(=CC(=C1)F)C(=O)OC.Cl

Computed by PubChem (NCBI)