Products 2061996-60-7
CAS 2061996-60-7 appears in our catalog under these names: (R)-Ethyl 2-amino-3-(4-fluorophenyl)propanoate hydrochloride, 95%, (R)–Ethyl 2–amino–3–(4–fluorophenyl)propanoate hydrochloride, (R)-Ethyl 2-amino-3-(4-fluorophenyl)propanoate hydrochloride, 98%, 98%, Ethyl (R)-2-amino-3-(4-fluorophenyl)propionate hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
Ethyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride (CAS 2061996-60-7) is a chemical compound with the molecular formula C11H15ClFNO2 and a molecular weight of 247.69 g/mol. IUPAC name: ethyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: KMTPBETYAVWMHD-HNCPQSOCSA-N.
| Molecular formula | C11H15ClFNO2 |
|---|---|
| Molecular weight | 247.69 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | KMTPBETYAVWMHD-HNCPQSOCSA-N |
| SMILES | CCOC(=O)[C@@H](CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)