cas: 5397-14-8 — see every product listed under this CAS number, including other names
Ethyl [(4-chlorophenyl)amino](oxo)acetate, 97%, 97% (CAS 5397-14-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DB6Z-50mg |
| cas | 5397-14-8 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 203.60 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1211.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4-chloroanilino)-2-oxoacetate (CAS 5397-14-8) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: ethyl 2-(4-chloroanilino)-2-oxoacetate. InChIKey: JFAOXNRPSKOLNC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | ethyl 2-(4-chloroanilino)-2-oxoacetate |
| InChIKey | JFAOXNRPSKOLNC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)