Products 1056427-10-1

CAS 1056427-10-1 is the registry number for 2-Methyl-2-(2-nitrophenyl)propanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-methyl-2-(2-nitrophenyl)propanoyl chloride (CAS 1056427-10-1) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: 2-methyl-2-(2-nitrophenyl)propanoyl chloride. InChIKey: NWGVLVBRUNFGHY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO3
Molecular weight227.64 g/mol
IUPAC name2-methyl-2-(2-nitrophenyl)propanoyl chloride
InChIKeyNWGVLVBRUNFGHY-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=CC=C1[N+](=O)[O-])C(=O)Cl

Computed by PubChem (NCBI)