CAS 83449-17-6 is the registry number for N-1,3-Benzodioxol-5-yl-3-chloropropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
N-(1,3-benzodioxol-5-yl)-3-chloropropanamide (CAS 83449-17-6) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-3-chloropropanamide. InChIKey: PMZCNFYSDCOWEK-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-3-chloropropanamide |
| InChIKey | PMZCNFYSDCOWEK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)CCCl |
Computed by PubChem (NCBI)