Products 1265236-34-7
CAS 1265236-34-7 is the registry number for 1-Chloro-2-(cyclopropylmethoxy)-4-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g.
1-chloro-2-(cyclopropylmethoxy)-4-nitrobenzene (CAS 1265236-34-7) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: 1-chloro-2-(cyclopropylmethoxy)-4-nitrobenzene. InChIKey: QMJYEEVSIREZCG-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | 1-chloro-2-(cyclopropylmethoxy)-4-nitrobenzene |
| InChIKey | QMJYEEVSIREZCG-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)