cas: 170844-49-2 — see every product listed under this CAS number, including other names
Ethyl 1-Boc-3-pyrrolidine-carboxylate, 95% (CAS 170844-49-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043004-1G |
| cas | 170844-49-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 263.47 Pln | |
| Fluorochem | 25g | 581.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-O-tert-butyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate (CAS 170844-49-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate. InChIKey: PKDQVUYUWUHNMG-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate |
| InChIKey | PKDQVUYUWUHNMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)