Products 1421256-03-2

CAS 1421256-03-2 is the registry number for (S)-1-Boc-pyrrolidine-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-ethyl (3S)-pyrrolidine-1,3-dicarboxylate (CAS 1421256-03-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S)-pyrrolidine-1,3-dicarboxylate. InChIKey: PKDQVUYUWUHNMG-VIFPVBQESA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl (3S)-pyrrolidine-1,3-dicarboxylate
InChIKeyPKDQVUYUWUHNMG-VIFPVBQESA-N
SMILESCCOC(=O)[C@H]1CCN(C1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)