CAS 1421256-03-2 is the registry number for (S)-1-Boc-pyrrolidine-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-O-tert-butyl 3-O-ethyl (3S)-pyrrolidine-1,3-dicarboxylate (CAS 1421256-03-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S)-pyrrolidine-1,3-dicarboxylate. InChIKey: PKDQVUYUWUHNMG-VIFPVBQESA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S)-pyrrolidine-1,3-dicarboxylate |
| InChIKey | PKDQVUYUWUHNMG-VIFPVBQESA-N |
| SMILES | CCOC(=O)[C@H]1CCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)