cas: 773134-90-0 — see every product listed under this CAS number, including other names
Ethyl 2,3,6-trifluorobenzoate 95% (CAS 773134-90-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A909689-250mg |
| cas | 773134-90-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 1343.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A909689 |
Ethyl 2,3,6-trifluorobenzoate (CAS 773134-90-0) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: ethyl 2,3,6-trifluorobenzoate. InChIKey: KTSYUGKWNTYIGK-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | ethyl 2,3,6-trifluorobenzoate |
| InChIKey | KTSYUGKWNTYIGK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)F)F |
Computed by PubChem (NCBI)