cas: 91013-20-6 — see every product listed under this CAS number, including other names
Ethyl 2,6-dimethoxyisonicotinate (CAS 91013-20-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632847-1G |
| cas | 91013-20-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3361.33 Pln | |
| Fluorochem | 5g | 9963.18 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 2,6-dimethoxypyridine-4-carboxylate (CAS 91013-20-6) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: ethyl 2,6-dimethoxypyridine-4-carboxylate. InChIKey: HPFDJKPSNCTYFG-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | ethyl 2,6-dimethoxypyridine-4-carboxylate |
| InChIKey | HPFDJKPSNCTYFG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)OC)OC |
Computed by PubChem (NCBI)