CAS 17483-54-4 appears in our catalog under these names: 2,4,6-Trimethoxybenzamide, 95%, 2,4,6-Trimethoxybenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 50g.
2,4,6-trimethoxybenzamide (CAS 17483-54-4) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 2,4,6-trimethoxybenzamide. InChIKey: MJBSQLQOPRALIV-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 2,4,6-trimethoxybenzamide |
| InChIKey | MJBSQLQOPRALIV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)N)OC |
Computed by PubChem (NCBI)