cas: 72648-80-7 — see every product listed under this CAS number, including other names
Ethyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate, 98%, 98% (CAS 72648-80-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SMM-100mg |
| cas | 72648-80-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 558.80 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 100g | 3784.40 Pln | |
| Chemat | 50g | 1994.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate (CAS 72648-80-7) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate. InChIKey: WVFXXOLKYIPCAX-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate |
| InChIKey | WVFXXOLKYIPCAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)