cas: 1228690-72-9 — see every product listed under this CAS number, including other names
Ethyl 2-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate, 98% (CAS 1228690-72-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A606351-5g |
| cas | 1228690-72-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17204.32 Pln | |
| Fluorochem | 50mg | 1028.82 Pln | |
| Fluorochem | 100mg | 1403.69 Pln | |
| Fluorochem | 250mg | 2356.48 Pln | |
| Fluorochem | 1g | 8494.94 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 1228690-72-9) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: ethyl 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: HPGZZDGRCJGYFU-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | ethyl 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | HPGZZDGRCJGYFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CC(=O)OCC |
Computed by PubChem (NCBI)