cas: 885278-78-4 — see every product listed under this CAS number, including other names
Ethyl 2-(2-bromophenyl)thiazole-4-carboxylate, 95% (CAS 885278-78-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224220-1G |
| cas | 885278-78-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 25g | 1320.39 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(2-bromophenyl)-1,3-thiazole-4-carboxylate (CAS 885278-78-4) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 2-(2-bromophenyl)-1,3-thiazole-4-carboxylate. InChIKey: CPLANXDOXGJYNP-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 2-(2-bromophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | CPLANXDOXGJYNP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)