Products 1053656-92-0

CAS 1053656-92-0 is the registry number for 2-(4-Bromobenzyl)thiazole-4-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[2-[(4-bromophenyl)methyl]-1,3-thiazol-4-yl]acetic acid (CAS 1053656-92-0) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: 2-[2-[(4-bromophenyl)methyl]-1,3-thiazol-4-yl]acetic acid. InChIKey: LMJCAGYWYSQRTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrNO2S
Molecular weight312.18 g/mol
IUPAC name2-[2-[(4-bromophenyl)methyl]-1,3-thiazol-4-yl]acetic acid
InChIKeyLMJCAGYWYSQRTQ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC2=NC(=CS2)CC(=O)O)Br

Computed by PubChem (NCBI)