CAS 914347-21-0 appears in our catalog under these names: 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester, 97%, Ethyl 5–bromo–2–phenylthiazole–4–carboxylate, 4-Thiazolecarboxylic acid, 5-bromo-2-phenyl-, ethyl ester, 98%, 98%, Ethyl 5-bromo-2-phenylthiazole-4-carboxylate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
Ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate (CAS 914347-21-0) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate. InChIKey: ONAJVAODOMRERW-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate |
| InChIKey | ONAJVAODOMRERW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)