CAS 786654-97-5 is the registry number for 2-(3-Bromo-phenyl)-thiazole-4-carboxylic acid ethyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS 786654-97-5) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate. InChIKey: DXNNRQNTJYNOPB-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | DXNNRQNTJYNOPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)