Products 786654-97-5

CAS 786654-97-5 is the registry number for 2-(3-Bromo-phenyl)-thiazole-4-carboxylic acid ethyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate (CAS 786654-97-5) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate. InChIKey: DXNNRQNTJYNOPB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrNO2S
Molecular weight312.18 g/mol
IUPAC nameethyl 2-(3-bromophenyl)-1,3-thiazole-4-carboxylate
InChIKeyDXNNRQNTJYNOPB-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2=CC(=CC=C2)Br

Computed by PubChem (NCBI)