Products 2375033-35-3
CAS 2375033-35-3 is the registry number for Febuxostat 2-Butyl Isomer Ethyl Ester. Offered by: TRC. Available pack sizes: 1g.
Ethyl 2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylate (CAS 2375033-35-3) is a chemical compound with the molecular formula C18H20N2O3S and a molecular weight of 344.4 g/mol. IUPAC name: ethyl 2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: BAJUCUHABAUVRC-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | ethyl 2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | BAJUCUHABAUVRC-UHFFFAOYSA-N |
| SMILES | CCC(C)OC1=C(C=C(C=C1)C2=NC(=C(S2)C(=O)OCC)C)C#N |
Computed by PubChem (NCBI)