Products 52461-83-3
CAS 52461-83-3 appears in our catalog under these names: 1-BENZYL-3-METHYL-3-IMIDAZOLIUM 4-METHYLBENZENESULFONATE, 97%, 3–benzyl–1–methyl–1H–imidazol–3–ium 4–methylbenzenesulfonate, 1-Benzyl-3-methyl-1H-imidazol-3-ium 4-methylbenzenesulfonate 99%, 1-Benzyl-3-Methyl-1H-Imidazol-3-Ium 4-Methylbenzenesulfonate, 99%, 99%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 100g, 5g, 1g.
1-benzyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate (CAS 52461-83-3) is a chemical compound with the molecular formula C18H20N2O3S and a molecular weight of 344.4 g/mol. IUPAC name: 1-benzyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate. InChIKey: UDTMKPOKOKZLFT-UHFFFAOYSA-M.
| Molecular formula | C18H20N2O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 1-benzyl-3-methylimidazol-3-ium;4-methylbenzenesulfonate |
| InChIKey | UDTMKPOKOKZLFT-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CN(C=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)