CAS 86408-42-6 appears in our catalog under these names: Diltiazem Impurity 8, Deacetyl-N,O-didemethyldiltiazem. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 500mg.
(2S,3S)-3-hydroxy-2-(4-hydroxyphenyl)-5-[2-(methylamino)ethyl]-2,3-dihydro-1,5-benzothiazepin-4-one (CAS 86408-42-6) is a chemical compound with the molecular formula C18H20N2O3S and a molecular weight of 344.4 g/mol. IUPAC name: (2S,3S)-3-hydroxy-2-(4-hydroxyphenyl)-5-[2-(methylamino)ethyl]-2,3-dihydro-1,5-benzothiazepin-4-one. InChIKey: ZTRZZXJIQHVVGS-SJORKVTESA-N.
| Molecular formula | C18H20N2O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (2S,3S)-3-hydroxy-2-(4-hydroxyphenyl)-5-[2-(methylamino)ethyl]-2,3-dihydro-1,5-benzothiazepin-4-one |
| InChIKey | ZTRZZXJIQHVVGS-SJORKVTESA-N |
| SMILES | CNCCN1C2=CC=CC=C2S[C@H]([C@H](C1=O)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)