cas: 269410-28-8 — see every product listed under this CAS number, including other names
Ethyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetate 97% (CAS 269410-28-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A486917-250mg |
| cas | 269410-28-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 2167.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A486917 |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate (CAS 269410-28-8) is a chemical compound with the molecular formula C16H23BO5 and a molecular weight of 306.2 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate. InChIKey: IWVRBFCAALMWBP-UHFFFAOYSA-N.
| Molecular formula | C16H23BO5 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
| InChIKey | IWVRBFCAALMWBP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(=O)OCC |
Computed by PubChem (NCBI)