cas: 209667-59-4 — see every product listed under this CAS number, including other names
Ethyl 2-(4-Boc-1-piperazinyl)acetate 97% (CAS 209667-59-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A331362-1g |
| cas | 209667-59-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1032.31 Pln | |
| Ambeed | 10g | 1989.06 Pln | |
| Ambeed | 25g | 3646.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A331362 |
Tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate (CAS 209667-59-4) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate. InChIKey: BWRNREIEPIQCOI-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 4-(2-ethoxy-2-oxoethyl)piperazine-1-carboxylate |
| InChIKey | BWRNREIEPIQCOI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)