cas: 1446332-73-5 — see every product listed under this CAS number, including other names
Ethyl 2-(4-chlorobenzo[d]oxazol-2-yl)acetate 98+% (CAS 1446332-73-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A763957-250mg |
| cas | 1446332-73-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Ambeed | 5g | 4358.69 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A763957 |
Ethyl 2-(4-chloro-1,3-benzoxazol-2-yl)acetate (CAS 1446332-73-5) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: ethyl 2-(4-chloro-1,3-benzoxazol-2-yl)acetate. InChIKey: WEGKCVYCZQSJLF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | ethyl 2-(4-chloro-1,3-benzoxazol-2-yl)acetate |
| InChIKey | WEGKCVYCZQSJLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=C(O1)C=CC=C2Cl |
Computed by PubChem (NCBI)