Products 92847-41-1

CAS 92847-41-1 is the registry number for 1-(3-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 2.5g.

Structural formula: {0} (CAS {1})

1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 92847-41-1) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: PBIAEAYJEYOSMG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNO3
Molecular weight239.65 g/mol
IUPAC name1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyPBIAEAYJEYOSMG-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC(=CC=C2)Cl)C(=O)O

Computed by PubChem (NCBI)