CAS 92847-41-1 is the registry number for 1-(3-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.
1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 92847-41-1) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: PBIAEAYJEYOSMG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | PBIAEAYJEYOSMG-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)