Ethyl 2-(6'-cyano-5'-oxo-3',5'-dihydro-2'H-spiro[[1,3]dioxolane-2,1'-indolizin]-7'-yl)acetate, 95%
cas: 58610-65-4 — see every product listed under this CAS number, including other names
Ethyl 2-(6'-cyano-5'-oxo-3',5'-dihydro-2'H-spiro[[1,3]dioxolane-2,1'-indolizin]-7'-yl)acetate, 95% (CAS 58610-65-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A511604-250mg |
| cas | 58610-65-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 1844.44 Pln | |
| Ambeed | 10g | 3168.31 Pln | |
| Ambeed | 25g | 6283.31 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 269.93 Pln | |
| BLDpharm | 1g | 642.02 Pln | |
| BLDpharm | 5g | 1980.44 Pln | |
| BLDpharm | 10g | 3407.71 Pln | |
| BLDpharm | 25g | 6767.64 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 597.20 Pln | |
| Chemat | 5g | 1850.00 Pln | |
| Chemat | 10g | 3179.60 Pln | |
| Chemat | 25g | 6314.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 2-(6'-cyano-5'-oxospiro[1,3-dioxolane-2,1'-2,3-dihydroindolizine]-7'-yl)acetate (CAS 58610-65-4) is a chemical compound with the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. IUPAC name: ethyl 2-(6'-cyano-5'-oxospiro[1,3-dioxolane-2,1'-2,3-dihydroindolizine]-7'-yl)acetate. InChIKey: FQVVPISPHQOPFC-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O5 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | ethyl 2-(6'-cyano-5'-oxospiro[1,3-dioxolane-2,1'-2,3-dihydroindolizine]-7'-yl)acetate |
| InChIKey | FQVVPISPHQOPFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C(=O)N2CCC3(C2=C1)OCCO3)C#N |
Computed by PubChem (NCBI)
Synonyms:
FQVVPISPHQOPFC-UHFFFAOYSA-N, Oprea1_624283