CAS 72669-53-5 appears in our catalog under these names: H-Glu(amc)-oh, 95%, L-Glutamic acid gamma-(7-amido-4-methylcoumarin), H–Glu(AMC)–OH, H-L-Glu(AMC)-OH, γ-L-Glutamic acid 7-amido-4-methylcoumarin trifluoroacetic acid. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 50mg, 25mg, 500mg, 5g, 0,25g.
(2S)-2-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentanoic acid (CAS 72669-53-5) is a chemical compound with the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. IUPAC name: (2S)-2-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentanoic acid. InChIKey: JPOAPPISZAGCAO-NSHDSACASA-N.
| Molecular formula | C15H16N2O5 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | (2S)-2-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentanoic acid |
| InChIKey | JPOAPPISZAGCAO-NSHDSACASA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)