CAS 98516-76-8 appears in our catalog under these names: H-Glu-amc, 95%, H–Glu–AMC, L-Glutamic acid ^a-(7-amido-4- , H-Glu-AMC, H-GLU-AMC, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 50mg, 1g, 250mg, 0,1g, 0,5g, 2,5g, 100mg, 100 mg.
(4S)-4-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentanoic acid (CAS 98516-76-8) is a chemical compound with the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. IUPAC name: (4S)-4-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentanoic acid. InChIKey: USALUSONPMPEKY-NSHDSACASA-N.
| Molecular formula | C15H16N2O5 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | (4S)-4-amino-5-[(4-methyl-2-oxochromen-7-yl)amino]-5-oxopentanoic acid |
| InChIKey | USALUSONPMPEKY-NSHDSACASA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCC(=O)O)N |
Computed by PubChem (NCBI)