Products 408537-42-8

CAS 408537-42-8 is the registry number for Alpha-Acetamino-Alpha-carboxy-(3-indole)-butyric Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

2-acetamido-2-[2-(1H-indol-3-yl)ethyl]propanedioic acid (CAS 408537-42-8) is a chemical compound with the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. IUPAC name: 2-acetamido-2-[2-(1H-indol-3-yl)ethyl]propanedioic acid. InChIKey: HLAXNURKPQFWIA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16N2O5
Molecular weight304.30 g/mol
IUPAC name2-acetamido-2-[2-(1H-indol-3-yl)ethyl]propanedioic acid
InChIKeyHLAXNURKPQFWIA-UHFFFAOYSA-N
SMILESCC(=O)NC(CCC1=CNC2=CC=CC=C21)(C(=O)O)C(=O)O

Computed by PubChem (NCBI)