CAS 408537-42-8 is the registry number for Alpha-Acetamino-Alpha-carboxy-(3-indole)-butyric Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.
2-acetamido-2-[2-(1H-indol-3-yl)ethyl]propanedioic acid (CAS 408537-42-8) is a chemical compound with the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. IUPAC name: 2-acetamido-2-[2-(1H-indol-3-yl)ethyl]propanedioic acid. InChIKey: HLAXNURKPQFWIA-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O5 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | 2-acetamido-2-[2-(1H-indol-3-yl)ethyl]propanedioic acid |
| InChIKey | HLAXNURKPQFWIA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CCC1=CNC2=CC=CC=C21)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)